C26H27NO4 — CID 154301300
7-(diethylamino)-3-[5-(4-ethoxyphenyl)penta-2,4-dienoyl]chromen-2-one (PubChem CID 154301300) has the molecular formula C26H27NO4 and a molecular weight of 417.51 g/mol. Its IUPAC name is 7-(diethylamino)-3-[5-(4-ethoxyphenyl)penta-2,4-dienoyl]chromen-2-one.
| Compound Name | 7-(diethylamino)-3-[5-(4-ethoxyphenyl)penta-2,4-dienoyl]chromen-2-one |
|---|---|
| PubChem CID | 154301300 |
| Molecular Formula | C26H27NO4 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 7-(diethylamino)-3-[5-(4-ethoxyphenyl)penta-2,4-dienoyl]chromen-2-one |
| SMILES | CCOc1ccc(C=CC=CC(=O)c2cc3ccc(N(CC)CC)cc3oc2=O)cc1 |
| InChI | InChI=1S/C26H27NO4/c1-4-27(5-2)21-14-13-20-17-23(26(29)31-25(20)18-21)24(28)10-8-7-9-19-11-15-22(16-12-19)30-6-3/h7-18H,4-6H2,1-3H3 |
| InChIKey | JFACJGOTFMCWRQ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|