C44H47N3O7 — CID 158998534
7-(diethylamino)-3-[3-[4-(diethylamino)phenyl]prop-2-enoyl]chromen-2-one;7-(diethylamino)-3-(furan-2-carbonyl)chromen-2-one (PubChem CID 158998534) has the molecular formula C44H47N3O7 and a molecular weight of 729.87 g/mol. Its IUPAC name is 7-(diethylamino)-3-[3-[4-(diethylamino)phenyl]prop-2-enoyl]chromen-2-one;7-(diethylamino)-3-(furan-2-carbonyl)chromen-2-one.
| Compound Name | 7-(diethylamino)-3-[3-[4-(diethylamino)phenyl]prop-2-enoyl]chromen-2-one;7-(diethylamino)-3-(furan-2-carbonyl)chromen-2-one |
|---|---|
| PubChem CID | 158998534 |
| Molecular Formula | C44H47N3O7 |
| Molecular Weight | 729.87 g/mol |
| Exact Mass | 729.34 |
| IUPAC Name | 7-(diethylamino)-3-[3-[4-(diethylamino)phenyl]prop-2-enoyl]chromen-2-one;7-(diethylamino)-3-(furan-2-carbonyl)chromen-2-one |
| SMILES | CCN(CC)c1ccc(C=CC(=O)c2cc3ccc(N(CC)CC)cc3oc2=O)cc1.CCN(CC)c1ccc2cc(C(=O)c3ccco3)c(=O)oc2c1 |
| InChI | InChI=1S/C26H30N2O3.C18H17NO4/c1-5-27(6-2)21-13-9-19(10-14-21)11-16-24(29)23-17-20-12-15-22(28(7-3)8-4)18-25(20)31-26(23)30;1-3-19(4-2)13-8-7-12-10-14(18(21)23-16(12)11-13)17(20)15-6-5-9-22-15/h9-18H,5-8H2,1-4H3;5-11H,3-4H2,1-2H3 |
| InChIKey | JRAXVTOPESDAKQ-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 117.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.87 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|