C29H32N2O7S — CID 132937563
(2S)-2-amino-4-[3-[4-[(E)-3-[7-(diethylamino)-2-oxochromen-3-yl]-3-oxoprop-1-enyl]phenoxy]-3-oxopropyl]sulfanylbutanoic acid (PubChem CID 132937563) has the molecular formula C29H32N2O7S and a molecular weight of 552.65 g/mol. Its IUPAC name is (2S)-2-amino-4-[3-[4-[(E)-3-[7-(diethylamino)-2-oxochromen-3-yl]-3-oxoprop-1-enyl]phenoxy]-3-oxopropyl]sulfanylbutanoic acid.
| Compound Name | (2S)-2-amino-4-[3-[4-[(E)-3-[7-(diethylamino)-2-oxochromen-3-yl]-3-oxoprop-1-enyl]phenoxy]-3-oxopropyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 132937563 |
| Molecular Formula | C29H32N2O7S |
| Molecular Weight | 552.65 g/mol |
| Exact Mass | 552.19 |
| IUPAC Name | (2S)-2-amino-4-[3-[4-[(E)-3-[7-(diethylamino)-2-oxochromen-3-yl]-3-oxoprop-1-enyl]phenoxy]-3-oxopropyl]sulfanylbutanoic acid |
| SMILES | CCN(CC)c1ccc2cc(C(=O)/C=C/c3ccc(OC(=O)CCSCC[C@H](N)C(=O)O)cc3)c(=O)oc2c1 |
| InChI | InChI=1S/C29H32N2O7S/c1-3-31(4-2)21-9-8-20-17-23(29(36)38-26(20)18-21)25(32)12-7-19-5-10-22(11-6-19)37-27(33)14-16-39-15-13-24(30)28(34)35/h5-12,17-18,24H,3-4,13-16,30H2,1-2H3,(H,34,35)/b12-7+/t24-/m0/s1 |
| InChIKey | UWGJOYPUFYUJKM-SZIFGRNDSA-N |
| XLogP | 4.37 |
| TPSA | 140.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.65 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|