About [7-(diethylamino)-2-oxochromen-3-yl]methyl acetate;propane
[7-(diethylamino)-2-oxochromen-3-yl]methyl acetate;propane (PubChem CID 142122971) has the molecular formula C19H27NO4
and a molecular weight of 333.43 g/mol. Its IUPAC name is [7-(diethylamino)-2-oxochromen-3-yl]methyl acetate;propane.
Molecular Properties
| Compound Name | [7-(diethylamino)-2-oxochromen-3-yl]methyl acetate;propane |
| PubChem CID | 142122971 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | [7-(diethylamino)-2-oxochromen-3-yl]methyl acetate;propane |
| SMILES | CCC.CCN(CC)c1ccc2cc(COC(C)=O)c(=O)oc2c1 |
| InChI | InChI=1S/C16H19NO4.C3H8/c1-4-17(5-2)14-7-6-12-8-13(10-20-11(3)18)16(19)21-15(12)9-14;1-3-2/h6-9H,4-5,10H2,1-3H3;3H2,1-2H3 |
| InChIKey | FBERJDMEXVMBSM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze [7-(diethylamino)-2-oxochromen-3-yl]methyl acetate;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [7-(diethylamino)-2-oxochromen-3-yl]methyl acetate;propane?
The IUPAC name of [7-(diethylamino)-2-oxochromen-3-yl]methyl acetate;propane (CID 142122971) is [7-(diethylamino)-2-oxochromen-3-yl]methyl acetate;propane.
What is the SMILES notation for [7-(diethylamino)-2-oxochromen-3-yl]methyl acetate;propane?
The canonical SMILES for [7-(diethylamino)-2-oxochromen-3-yl]methyl acetate;propane is CCC.CCN(CC)c1ccc2cc(COC(C)=O)c(=O)oc2c1.
What is the InChIKey of [7-(diethylamino)-2-oxochromen-3-yl]methyl acetate;propane?
The InChIKey is FBERJDMEXVMBSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO4.C3H8/c1-4-17(5-2)14-7-6-12-8-13(10-20-11(3)18)16(19)21-15(12)9-14;1-3-2/h6-9H,4-5,10H2,1-3H3;3H2,1-2H3.
What are the key properties of [7-(diethylamino)-2-oxochromen-3-yl]methyl acetate;propane?
[7-(diethylamino)-2-oxochromen-3-yl]methyl acetate;propane has a molecular weight of 333.43 g/mol, XLogP of 4.12, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [7-(diethylamino)-2-oxochromen-3-yl]methyl acetate;propane is sourced from PubChem (CID 142122971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).