C16H18N2O4 — CID 118983417
7-(dipropylamino)-N,2-dioxochromene-3-carboxamide (PubChem CID 118983417) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is 7-(dipropylamino)-N,2-dioxochromene-3-carboxamide.
| Compound Name | 7-(dipropylamino)-N,2-dioxochromene-3-carboxamide |
|---|---|
| PubChem CID | 118983417 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 7-(dipropylamino)-N,2-dioxochromene-3-carboxamide |
| SMILES | CCCN(CCC)c1ccc2cc(C(=O)N=O)c(=O)oc2c1 |
| InChI | InChI=1S/C16H18N2O4/c1-3-7-18(8-4-2)12-6-5-11-9-13(15(19)17-21)16(20)22-14(11)10-12/h5-6,9-10H,3-4,7-8H2,1-2H3 |
| InChIKey | FBZVMRPLTDZJQF-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 79.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|