C24H19FN2O4 — CID 51368055
2-(3-fluoro-4-methoxyphenyl)imino-N-(4-methoxyphenyl)chromene-3-carboxamide (PubChem CID 51368055) has the molecular formula C24H19FN2O4 and a molecular weight of 418.42 g/mol. Its IUPAC name is 2-(3-fluoro-4-methoxyphenyl)imino-N-(4-methoxyphenyl)chromene-3-carboxamide.
| Compound Name | 2-(3-fluoro-4-methoxyphenyl)imino-N-(4-methoxyphenyl)chromene-3-carboxamide |
|---|---|
| PubChem CID | 51368055 |
| Molecular Formula | C24H19FN2O4 |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 2-(3-fluoro-4-methoxyphenyl)imino-N-(4-methoxyphenyl)chromene-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cc3ccccc3o/c2=N\c2ccc(OC)c(F)c2)cc1 |
| InChI | InChI=1S/C24H19FN2O4/c1-29-18-10-7-16(8-11-18)26-23(28)19-13-15-5-3-4-6-21(15)31-24(19)27-17-9-12-22(30-2)20(25)14-17/h3-14H,1-2H3,(H,26,28)/b27-24- |
| InChIKey | PCIVONKFIUCYRT-PNHLSOANSA-N |
| XLogP | 5.07 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |