C24H19FN2O2 — CID 51367934
N-(2,4-dimethylphenyl)-2-(2-fluorophenyl)iminochromene-3-carboxamide (PubChem CID 51367934) has the molecular formula C24H19FN2O2 and a molecular weight of 386.43 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-2-(2-fluorophenyl)iminochromene-3-carboxamide.
| Compound Name | N-(2,4-dimethylphenyl)-2-(2-fluorophenyl)iminochromene-3-carboxamide |
|---|---|
| PubChem CID | 51367934 |
| Molecular Formula | C24H19FN2O2 |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | N-(2,4-dimethylphenyl)-2-(2-fluorophenyl)iminochromene-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cc3ccccc3o/c2=N\c2ccccc2F)c(C)c1 |
| InChI | InChI=1S/C24H19FN2O2/c1-15-11-12-20(16(2)13-15)26-23(28)18-14-17-7-3-6-10-22(17)29-24(18)27-21-9-5-4-8-19(21)25/h3-14H,1-2H3,(H,26,28)/b27-24- |
| InChIKey | COYIIWPYDWCXGB-PNHLSOANSA-N |
| XLogP | 5.67 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |