C21H14FN3O2 — CID 51367722
2-(2-fluorophenyl)imino-N-pyridin-2-ylchromene-3-carboxamide (PubChem CID 51367722) has the molecular formula C21H14FN3O2 and a molecular weight of 359.36 g/mol. Its IUPAC name is 2-(2-fluorophenyl)imino-N-pyridin-2-ylchromene-3-carboxamide.
| Compound Name | 2-(2-fluorophenyl)imino-N-pyridin-2-ylchromene-3-carboxamide |
|---|---|
| PubChem CID | 51367722 |
| Molecular Formula | C21H14FN3O2 |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 2-(2-fluorophenyl)imino-N-pyridin-2-ylchromene-3-carboxamide |
| SMILES | O=C(Nc1ccccn1)c1cc2ccccc2o/c1=N\c1ccccc1F |
| InChI | InChI=1S/C21H14FN3O2/c22-16-8-2-3-9-17(16)24-21-15(13-14-7-1-4-10-18(14)27-21)20(26)25-19-11-5-6-12-23-19/h1-13H,(H,23,25,26)/b24-21- |
| InChIKey | PTRZCGBKSSQBSH-FLFQWRMESA-N |
| XLogP | 4.45 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |