C21H13F2N3O2 — CID 51367726
2-(2,5-difluorophenyl)imino-N-pyridin-2-ylchromene-3-carboxamide (PubChem CID 51367726) has the molecular formula C21H13F2N3O2 and a molecular weight of 377.35 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)imino-N-pyridin-2-ylchromene-3-carboxamide.
| Compound Name | 2-(2,5-difluorophenyl)imino-N-pyridin-2-ylchromene-3-carboxamide |
|---|---|
| PubChem CID | 51367726 |
| Molecular Formula | C21H13F2N3O2 |
| Molecular Weight | 377.35 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 2-(2,5-difluorophenyl)imino-N-pyridin-2-ylchromene-3-carboxamide |
| SMILES | O=C(Nc1ccccn1)c1cc2ccccc2o/c1=N\c1cc(F)ccc1F |
| InChI | InChI=1S/C21H13F2N3O2/c22-14-8-9-16(23)17(12-14)25-21-15(11-13-5-1-2-6-18(13)28-21)20(27)26-19-7-3-4-10-24-19/h1-12H,(H,24,26,27)/b25-21- |
| InChIKey | SPTZZIQECCEYRX-DAFNUICNSA-N |
| XLogP | 4.59 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.35 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |