C22H15ClFN3O3 — CID 51367154
2-(2-chloro-4-fluorophenyl)imino-8-methoxy-N-pyridin-2-ylchromene-3-carboxamide (PubChem CID 51367154) has the molecular formula C22H15ClFN3O3 and a molecular weight of 423.83 g/mol. Its IUPAC name is 2-(2-chloro-4-fluorophenyl)imino-8-methoxy-N-pyridin-2-ylchromene-3-carboxamide.
| Compound Name | 2-(2-chloro-4-fluorophenyl)imino-8-methoxy-N-pyridin-2-ylchromene-3-carboxamide |
|---|---|
| PubChem CID | 51367154 |
| Molecular Formula | C22H15ClFN3O3 |
| Molecular Weight | 423.83 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | 2-(2-chloro-4-fluorophenyl)imino-8-methoxy-N-pyridin-2-ylchromene-3-carboxamide |
| SMILES | COc1cccc2cc(C(=O)Nc3ccccn3)/c(=N/c3ccc(F)cc3Cl)oc12 |
| InChI | InChI=1S/C22H15ClFN3O3/c1-29-18-6-4-5-13-11-15(21(28)27-19-7-2-3-10-25-19)22(30-20(13)18)26-17-9-8-14(24)12-16(17)23/h2-12H,1H3,(H,25,27,28)/b26-22- |
| InChIKey | LMGFKKZEUDUMOT-ROMGYVFFSA-N |
| XLogP | 5.11 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.83 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |