C32H33N3O5 — CID 2134703
N-(4-methylphenyl)-4-(3,4,5-trimethoxyphenyl)imino-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraene-5-carboxamide (PubChem CID 2134703) has the molecular formula C32H33N3O5 and a molecular weight of 539.63 g/mol. Its IUPAC name is N-(4-methylphenyl)-4-(3,4,5-trimethoxyphenyl)imino-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraene-5-carboxamide.
| Compound Name | N-(4-methylphenyl)-4-(3,4,5-trimethoxyphenyl)imino-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 2134703 |
| Molecular Formula | C32H33N3O5 |
| Molecular Weight | 539.63 g/mol |
| Exact Mass | 539.24 |
| IUPAC Name | N-(4-methylphenyl)-4-(3,4,5-trimethoxyphenyl)imino-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraene-5-carboxamide |
| SMILES | COc1cc(/N=c2\oc3c4c5c(cc3cc2C(=O)Nc2ccc(C)cc2)CCCN5CCC4)cc(OC)c1OC |
| InChI | InChI=1S/C32H33N3O5/c1-19-9-11-22(12-10-19)33-31(36)25-16-21-15-20-7-5-13-35-14-6-8-24(28(20)35)29(21)40-32(25)34-23-17-26(37-2)30(39-4)27(18-23)38-3/h9-12,15-18H,5-8,13-14H2,1-4H3,(H,33,36)/b34-32- |
| InChIKey | DGHWVVVMJAVKAY-YJKCNMNRSA-N |
| XLogP | 5.95 |
| TPSA | 85.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.63 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |