C27H36N2O9 — CID 59257651
3-[2-[2-[2-[2-[(4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraene-5-carbonyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (PubChem CID 59257651) has the molecular formula C27H36N2O9 and a molecular weight of 532.59 g/mol. Its IUPAC name is 3-[2-[2-[2-[2-[(4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraene-5-carbonyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid.
| Compound Name | 3-[2-[2-[2-[2-[(4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraene-5-carbonyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 59257651 |
| Molecular Formula | C27H36N2O9 |
| Molecular Weight | 532.59 g/mol |
| Exact Mass | 532.24 |
| IUPAC Name | 3-[2-[2-[2-[2-[(4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraene-5-carbonyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| SMILES | O=C(O)CCOCCOCCOCCOCCNC(=O)c1cc2cc3c4c(c2oc1=O)CCCN4CCC3 |
| InChI | InChI=1S/C27H36N2O9/c30-23(31)5-9-34-11-13-36-15-16-37-14-12-35-10-6-28-26(32)22-18-20-17-19-3-1-7-29-8-2-4-21(24(19)29)25(20)38-27(22)33/h17-18H,1-16H2,(H,28,32)(H,30,31) |
| InChIKey | NXQRXTYIRZZLQI-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 136.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.59 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|