C18H16IN3O2 — CID 15716569
6-imidazol-1-yl-5-iodo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-4-one (PubChem CID 15716569) has the molecular formula C18H16IN3O2 and a molecular weight of 433.25 g/mol. Its IUPAC name is 6-imidazol-1-yl-5-iodo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-4-one.
| Compound Name | 6-imidazol-1-yl-5-iodo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-4-one |
|---|---|
| PubChem CID | 15716569 |
| Molecular Formula | C18H16IN3O2 |
| Molecular Weight | 433.25 g/mol |
| Exact Mass | 433.03 |
| IUPAC Name | 6-imidazol-1-yl-5-iodo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-4-one |
| SMILES | O=c1oc2c3c4c(cc2c(-n2ccnc2)c1I)CCCN4CCC3 |
| InChI | InChI=1S/C18H16IN3O2/c19-14-16(22-8-5-20-10-22)13-9-11-3-1-6-21-7-2-4-12(15(11)21)17(13)24-18(14)23/h5,8-10H,1-4,6-7H2 |
| InChIKey | MLPRDHFGFJQIFZ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 51.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.25 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|