C11H7BrO4 — CID 56650009
6-bromo-4-methyl-2-oxochromene-3-carboxylic acid (PubChem CID 56650009) has the molecular formula C11H7BrO4 and a molecular weight of 283.08 g/mol. Its IUPAC name is 6-bromo-4-methyl-2-oxochromene-3-carboxylic acid.
| Compound Name | 6-bromo-4-methyl-2-oxochromene-3-carboxylic acid |
|---|---|
| PubChem CID | 56650009 |
| Molecular Formula | C11H7BrO4 |
| Molecular Weight | 283.08 g/mol |
| Exact Mass | 281.95 |
| IUPAC Name | 6-bromo-4-methyl-2-oxochromene-3-carboxylic acid |
| SMILES | Cc1c(C(=O)O)c(=O)oc2ccc(Br)cc12 |
| InChI | InChI=1S/C11H7BrO4/c1-5-7-4-6(12)2-3-8(7)16-11(15)9(5)10(13)14/h2-4H,1H3,(H,13,14) |
| InChIKey | BWBWVUJRXNIUMA-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.08 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|