C17H19BrN2O3 — CID 119491505
6-bromo-4-methyl-3-[3-(methylamino)piperidine-1-carbonyl]chromen-2-one (PubChem CID 119491505) has the molecular formula C17H19BrN2O3 and a molecular weight of 379.25 g/mol. Its IUPAC name is 6-bromo-4-methyl-3-[3-(methylamino)piperidine-1-carbonyl]chromen-2-one.
| Compound Name | 6-bromo-4-methyl-3-[3-(methylamino)piperidine-1-carbonyl]chromen-2-one |
|---|---|
| PubChem CID | 119491505 |
| Molecular Formula | C17H19BrN2O3 |
| Molecular Weight | 379.25 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | 6-bromo-4-methyl-3-[3-(methylamino)piperidine-1-carbonyl]chromen-2-one |
| SMILES | CNC1CCCN(C(=O)c2c(C)c3cc(Br)ccc3oc2=O)C1 |
| InChI | InChI=1S/C17H19BrN2O3/c1-10-13-8-11(18)5-6-14(13)23-17(22)15(10)16(21)20-7-3-4-12(9-20)19-2/h5-6,8,12,19H,3-4,7,9H2,1-2H3 |
| InChIKey | NJSMZBJMVHJJDO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.25 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|