C17H20BrClN2O3 — CID 119423619
3-[4-(aminomethyl)piperidine-1-carbonyl]-6-bromo-4-methylchromen-2-one;hydrochloride (PubChem CID 119423619) has the molecular formula C17H20BrClN2O3 and a molecular weight of 415.72 g/mol. Its IUPAC name is 3-[4-(aminomethyl)piperidine-1-carbonyl]-6-bromo-4-methylchromen-2-one;hydrochloride.
| Compound Name | 3-[4-(aminomethyl)piperidine-1-carbonyl]-6-bromo-4-methylchromen-2-one;hydrochloride |
|---|---|
| PubChem CID | 119423619 |
| Molecular Formula | C17H20BrClN2O3 |
| Molecular Weight | 415.72 g/mol |
| Exact Mass | 414.03 |
| IUPAC Name | 3-[4-(aminomethyl)piperidine-1-carbonyl]-6-bromo-4-methylchromen-2-one;hydrochloride |
| SMILES | Cc1c(C(=O)N2CCC(CN)CC2)c(=O)oc2ccc(Br)cc12.Cl |
| InChI | InChI=1S/C17H19BrN2O3.ClH/c1-10-13-8-12(18)2-3-14(13)23-17(22)15(10)16(21)20-6-4-11(9-19)5-7-20;/h2-3,8,11H,4-7,9,19H2,1H3;1H |
| InChIKey | AEXYDPFKLVNUMG-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 76.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.72 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|