C14H16BrClN2O3 — CID 119407472
N-(3-aminopropyl)-6-bromo-4-methyl-2-oxochromene-3-carboxamide;hydrochloride (PubChem CID 119407472) has the molecular formula C14H16BrClN2O3 and a molecular weight of 375.65 g/mol. Its IUPAC name is N-(3-aminopropyl)-6-bromo-4-methyl-2-oxochromene-3-carboxamide;hydrochloride.
| Compound Name | N-(3-aminopropyl)-6-bromo-4-methyl-2-oxochromene-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119407472 |
| Molecular Formula | C14H16BrClN2O3 |
| Molecular Weight | 375.65 g/mol |
| Exact Mass | 374.00 |
| IUPAC Name | N-(3-aminopropyl)-6-bromo-4-methyl-2-oxochromene-3-carboxamide;hydrochloride |
| SMILES | Cc1c(C(=O)NCCCN)c(=O)oc2ccc(Br)cc12.Cl |
| InChI | InChI=1S/C14H15BrN2O3.ClH/c1-8-10-7-9(15)3-4-11(10)20-14(19)12(8)13(18)17-6-2-5-16;/h3-4,7H,2,5-6,16H2,1H3,(H,17,18);1H |
| InChIKey | KGECNNQYTIRNSQ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.65 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|