C12H8BrNO6 — CID 54746540
2-[(6-bromo-4-hydroxy-2-oxochromene-3-carbonyl)amino]acetic acid (PubChem CID 54746540) has the molecular formula C12H8BrNO6 and a molecular weight of 342.10 g/mol. Its IUPAC name is 2-[(6-bromo-4-hydroxy-2-oxochromene-3-carbonyl)amino]acetic acid.
| Compound Name | 2-[(6-bromo-4-hydroxy-2-oxochromene-3-carbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 54746540 |
| Molecular Formula | C12H8BrNO6 |
| Molecular Weight | 342.10 g/mol |
| Exact Mass | 340.95 |
| IUPAC Name | 2-[(6-bromo-4-hydroxy-2-oxochromene-3-carbonyl)amino]acetic acid |
| SMILES | O=C(O)CNC(=O)c1c(O)c2cc(Br)ccc2oc1=O |
| InChI | InChI=1S/C12H8BrNO6/c13-5-1-2-7-6(3-5)10(17)9(12(19)20-7)11(18)14-4-8(15)16/h1-3,17H,4H2,(H,14,18)(H,15,16) |
| InChIKey | ZZJGCGHVRHPFSS-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.10 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|