C16H16BrNO6 — CID 88856601
tert-butyl 2-[(8-bromo-4-hydroxy-2-oxochromene-3-carbonyl)amino]acetate (PubChem CID 88856601) has the molecular formula C16H16BrNO6 and a molecular weight of 398.21 g/mol. Its IUPAC name is tert-butyl 2-[(8-bromo-4-hydroxy-2-oxochromene-3-carbonyl)amino]acetate.
| Compound Name | tert-butyl 2-[(8-bromo-4-hydroxy-2-oxochromene-3-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 88856601 |
| Molecular Formula | C16H16BrNO6 |
| Molecular Weight | 398.21 g/mol |
| Exact Mass | 397.02 |
| IUPAC Name | tert-butyl 2-[(8-bromo-4-hydroxy-2-oxochromene-3-carbonyl)amino]acetate |
| SMILES | CC(C)(C)OC(=O)CNC(=O)c1c(O)c2cccc(Br)c2oc1=O |
| InChI | InChI=1S/C16H16BrNO6/c1-16(2,3)24-10(19)7-18-14(21)11-12(20)8-5-4-6-9(17)13(8)23-15(11)22/h4-6,20H,7H2,1-3H3,(H,18,21) |
| InChIKey | DXKIDCSLLFPMCV-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.21 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|