C19H15NO6 — CID 54734827
2-[[4-hydroxy-8-(4-methylphenyl)-2-oxochromene-3-carbonyl]amino]acetic acid (PubChem CID 54734827) has the molecular formula C19H15NO6 and a molecular weight of 353.33 g/mol. Its IUPAC name is 2-[[4-hydroxy-8-(4-methylphenyl)-2-oxochromene-3-carbonyl]amino]acetic acid.
| Compound Name | 2-[[4-hydroxy-8-(4-methylphenyl)-2-oxochromene-3-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 54734827 |
| Molecular Formula | C19H15NO6 |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 2-[[4-hydroxy-8-(4-methylphenyl)-2-oxochromene-3-carbonyl]amino]acetic acid |
| SMILES | Cc1ccc(-c2cccc3c(O)c(C(=O)NCC(=O)O)c(=O)oc23)cc1 |
| InChI | InChI=1S/C19H15NO6/c1-10-5-7-11(8-6-10)12-3-2-4-13-16(23)15(19(25)26-17(12)13)18(24)20-9-14(21)22/h2-8,23H,9H2,1H3,(H,20,24)(H,21,22) |
| InChIKey | HATJKDJVUKAARX-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|