C20H18N2O5 — CID 59340054
2-[[4-hydroxy-1-methyl-7-(2-methylphenyl)-2-oxoquinoline-3-carbonyl]amino]acetic acid (PubChem CID 59340054) has the molecular formula C20H18N2O5 and a molecular weight of 366.37 g/mol. Its IUPAC name is 2-[[4-hydroxy-1-methyl-7-(2-methylphenyl)-2-oxoquinoline-3-carbonyl]amino]acetic acid.
| Compound Name | 2-[[4-hydroxy-1-methyl-7-(2-methylphenyl)-2-oxoquinoline-3-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 59340054 |
| Molecular Formula | C20H18N2O5 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 2-[[4-hydroxy-1-methyl-7-(2-methylphenyl)-2-oxoquinoline-3-carbonyl]amino]acetic acid |
| SMILES | Cc1ccccc1-c1ccc2c(O)c(C(=O)NCC(=O)O)c(=O)n(C)c2c1 |
| InChI | InChI=1S/C20H18N2O5/c1-11-5-3-4-6-13(11)12-7-8-14-15(9-12)22(2)20(27)17(18(14)25)19(26)21-10-16(23)24/h3-9,25H,10H2,1-2H3,(H,21,26)(H,23,24) |
| InChIKey | ODXYDUCLSFKDJF-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 108.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |