About 2-[[7-(2,5-dichlorophenoxy)-4-hydroxy-1-methyl-2-oxoquinoline-3-carbonyl]amino]acetic acid
2-[[7-(2,5-dichlorophenoxy)-4-hydroxy-1-methyl-2-oxoquinoline-3-carbonyl]amino]acetic acid (PubChem CID 118934735) has the molecular formula C19H14Cl2N2O6
and a molecular weight of 437.24 g/mol. Its IUPAC name is 2-[[7-(2,5-dichlorophenoxy)-4-hydroxy-1-methyl-2-oxoquinoline-3-carbonyl]amino]acetic acid.
Molecular Properties
| Compound Name | 2-[[7-(2,5-dichlorophenoxy)-4-hydroxy-1-methyl-2-oxoquinoline-3-carbonyl]amino]acetic acid |
| PubChem CID | 118934735 |
| Molecular Formula | C19H14Cl2N2O6 |
| Molecular Weight | 437.24 g/mol |
| Exact Mass | 436.02 |
| IUPAC Name | 2-[[7-(2,5-dichlorophenoxy)-4-hydroxy-1-methyl-2-oxoquinoline-3-carbonyl]amino]acetic acid |
| SMILES | Cn1c(=O)c(C(=O)NCC(=O)O)c(O)c2ccc(Oc3cc(Cl)ccc3Cl)cc21 |
| InChI | InChI=1S/C19H14Cl2N2O6/c1-23-13-7-10(29-14-6-9(20)2-5-12(14)21)3-4-11(13)17(26)16(19(23)28)18(27)22-8-15(24)25/h2-7,26H,8H2,1H3,(H,22,27)(H,24,25) |
| InChIKey | DBBMLHQORKSVHE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 117.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.24 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[[7-(2,5-dichlorophenoxy)-4-hydroxy-1-methyl-2-oxoquinoline-3-carbonyl]amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[7-(2,5-dichlorophenoxy)-4-hydroxy-1-methyl-2-oxoquinoline-3-carbonyl]amino]acetic acid?
The IUPAC name of 2-[[7-(2,5-dichlorophenoxy)-4-hydroxy-1-methyl-2-oxoquinoline-3-carbonyl]amino]acetic acid (CID 118934735) is 2-[[7-(2,5-dichlorophenoxy)-4-hydroxy-1-methyl-2-oxoquinoline-3-carbonyl]amino]acetic acid.
What is the SMILES notation for 2-[[7-(2,5-dichlorophenoxy)-4-hydroxy-1-methyl-2-oxoquinoline-3-carbonyl]amino]acetic acid?
The canonical SMILES for 2-[[7-(2,5-dichlorophenoxy)-4-hydroxy-1-methyl-2-oxoquinoline-3-carbonyl]amino]acetic acid is Cn1c(=O)c(C(=O)NCC(=O)O)c(O)c2ccc(Oc3cc(Cl)ccc3Cl)cc21.
What is the InChIKey of 2-[[7-(2,5-dichlorophenoxy)-4-hydroxy-1-methyl-2-oxoquinoline-3-carbonyl]amino]acetic acid?
The InChIKey is DBBMLHQORKSVHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14Cl2N2O6/c1-23-13-7-10(29-14-6-9(20)2-5-12(14)21)3-4-11(13)17(26)16(19(23)28)18(27)22-8-15(24)25/h2-7,26H,8H2,1H3,(H,22,27)(H,24,25).
What are the key properties of 2-[[7-(2,5-dichlorophenoxy)-4-hydroxy-1-methyl-2-oxoquinoline-3-carbonyl]amino]acetic acid?
2-[[7-(2,5-dichlorophenoxy)-4-hydroxy-1-methyl-2-oxoquinoline-3-carbonyl]amino]acetic acid has a molecular weight of 437.24 g/mol, XLogP of 3.16, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[7-(2,5-dichlorophenoxy)-4-hydroxy-1-methyl-2-oxoquinoline-3-carbonyl]amino]acetic acid is sourced from PubChem (CID 118934735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).