About methyl 7-(3,5-dichlorophenoxy)-4-hydroxy-1-methyl-2-oxoquinoline-3-carboxylate
methyl 7-(3,5-dichlorophenoxy)-4-hydroxy-1-methyl-2-oxoquinoline-3-carboxylate (PubChem CID 130194527) has the molecular formula C18H13Cl2NO5
and a molecular weight of 394.21 g/mol. Its IUPAC name is methyl 7-(3,5-dichlorophenoxy)-4-hydroxy-1-methyl-2-oxoquinoline-3-carboxylate.
Molecular Properties
| Compound Name | methyl 7-(3,5-dichlorophenoxy)-4-hydroxy-1-methyl-2-oxoquinoline-3-carboxylate |
| PubChem CID | 130194527 |
| Molecular Formula | C18H13Cl2NO5 |
| Molecular Weight | 394.21 g/mol |
| Exact Mass | 393.02 |
| IUPAC Name | methyl 7-(3,5-dichlorophenoxy)-4-hydroxy-1-methyl-2-oxoquinoline-3-carboxylate |
| SMILES | COC(=O)c1c(O)c2ccc(Oc3cc(Cl)cc(Cl)c3)cc2n(C)c1=O |
| InChI | InChI=1S/C18H13Cl2NO5/c1-21-14-8-11(26-12-6-9(19)5-10(20)7-12)3-4-13(14)16(22)15(17(21)23)18(24)25-2/h3-8,22H,1-2H3 |
| InChIKey | OPRGENLPCIIHBY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.21 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 7-(3,5-dichlorophenoxy)-4-hydroxy-1-methyl-2-oxoquinoline-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-(3,5-dichlorophenoxy)-4-hydroxy-1-methyl-2-oxoquinoline-3-carboxylate?
The IUPAC name of methyl 7-(3,5-dichlorophenoxy)-4-hydroxy-1-methyl-2-oxoquinoline-3-carboxylate (CID 130194527) is methyl 7-(3,5-dichlorophenoxy)-4-hydroxy-1-methyl-2-oxoquinoline-3-carboxylate.
What is the SMILES notation for methyl 7-(3,5-dichlorophenoxy)-4-hydroxy-1-methyl-2-oxoquinoline-3-carboxylate?
The canonical SMILES for methyl 7-(3,5-dichlorophenoxy)-4-hydroxy-1-methyl-2-oxoquinoline-3-carboxylate is COC(=O)c1c(O)c2ccc(Oc3cc(Cl)cc(Cl)c3)cc2n(C)c1=O.
What is the InChIKey of methyl 7-(3,5-dichlorophenoxy)-4-hydroxy-1-methyl-2-oxoquinoline-3-carboxylate?
The InChIKey is OPRGENLPCIIHBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13Cl2NO5/c1-21-14-8-11(26-12-6-9(19)5-10(20)7-12)3-4-13(14)16(22)15(17(21)23)18(24)25-2/h3-8,22H,1-2H3.
What are the key properties of methyl 7-(3,5-dichlorophenoxy)-4-hydroxy-1-methyl-2-oxoquinoline-3-carboxylate?
methyl 7-(3,5-dichlorophenoxy)-4-hydroxy-1-methyl-2-oxoquinoline-3-carboxylate has a molecular weight of 394.21 g/mol, XLogP of 4.13, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-(3,5-dichlorophenoxy)-4-hydroxy-1-methyl-2-oxoquinoline-3-carboxylate is sourced from PubChem (CID 130194527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).