C20H16FNO6 — CID 157266952
4-[7-(2-fluorophenoxy)-4-hydroxy-1-methyl-2-oxoquinolin-3-yl]-4-oxobutanoic acid (PubChem CID 157266952) has the molecular formula C20H16FNO6 and a molecular weight of 385.35 g/mol. Its IUPAC name is 4-[7-(2-fluorophenoxy)-4-hydroxy-1-methyl-2-oxoquinolin-3-yl]-4-oxobutanoic acid.
| Compound Name | 4-[7-(2-fluorophenoxy)-4-hydroxy-1-methyl-2-oxoquinolin-3-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 157266952 |
| Molecular Formula | C20H16FNO6 |
| Molecular Weight | 385.35 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 4-[7-(2-fluorophenoxy)-4-hydroxy-1-methyl-2-oxoquinolin-3-yl]-4-oxobutanoic acid |
| SMILES | Cn1c(=O)c(C(=O)CCC(=O)O)c(O)c2ccc(Oc3ccccc3F)cc21 |
| InChI | InChI=1S/C20H16FNO6/c1-22-14-10-11(28-16-5-3-2-4-13(16)21)6-7-12(14)19(26)18(20(22)27)15(23)8-9-17(24)25/h2-7,10,26H,8-9H2,1H3,(H,24,25) |
| InChIKey | AYCIBSORUZMWDQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 105.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |