C17H11Cl2NO4 — CID 166804674
7-(3,4-dichlorophenoxy)-4-hydroxy-1-methyl-2-oxoquinoline-3-carbaldehyde (PubChem CID 166804674) has the molecular formula C17H11Cl2NO4 and a molecular weight of 364.18 g/mol. Its IUPAC name is 7-(3,4-dichlorophenoxy)-4-hydroxy-1-methyl-2-oxoquinoline-3-carbaldehyde.
| Compound Name | 7-(3,4-dichlorophenoxy)-4-hydroxy-1-methyl-2-oxoquinoline-3-carbaldehyde |
|---|---|
| PubChem CID | 166804674 |
| Molecular Formula | C17H11Cl2NO4 |
| Molecular Weight | 364.18 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | 7-(3,4-dichlorophenoxy)-4-hydroxy-1-methyl-2-oxoquinoline-3-carbaldehyde |
| SMILES | Cn1c(=O)c(C=O)c(O)c2ccc(Oc3ccc(Cl)c(Cl)c3)cc21 |
| InChI | InChI=1S/C17H11Cl2NO4/c1-20-15-7-10(24-9-3-5-13(18)14(19)6-9)2-4-11(15)16(22)12(8-21)17(20)23/h2-8,22H,1H3 |
| InChIKey | VTRYKSIRRKJNPK-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.18 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|