methyl 4-hydroxy-1,5,6-trimethyl-2-oxoquinoline-3-carboxylate

C14H15NO4 — CID 54737384

IUPACmethyl 4-hydroxy-1,5,6-trimethyl-2-oxoquinoline-3-carboxylate
SMILESCOC(=O)c1c(O)c2c(C)c(C)ccc2n(C)c1=O
InChIInChI=1S/C14H15NO4/c1-7-5-6-9-10(8(7)2)12(16)11(14(18)19-4)13(17)15(9)3/h5-6,16H,1-4H3
InChIKeyRNDOWDQJQXQRFR-UHFFFAOYSA-N
MW261.28 g/mol
LogP1.65
Rot. Bonds1

About methyl 4-hydroxy-1,5,6-trimethyl-2-oxoquinoline-3-carboxylate

methyl 4-hydroxy-1,5,6-trimethyl-2-oxoquinoline-3-carboxylate (PubChem CID 54737384) has the molecular formula C14H15NO4 and a molecular weight of 261.28 g/mol. Its IUPAC name is methyl 4-hydroxy-1,5,6-trimethyl-2-oxoquinoline-3-carboxylate.

Molecular Properties

Compound Namemethyl 4-hydroxy-1,5,6-trimethyl-2-oxoquinoline-3-carboxylate
PubChem CID54737384
Molecular FormulaC14H15NO4
Molecular Weight261.28 g/mol
Exact Mass261.10
IUPAC Namemethyl 4-hydroxy-1,5,6-trimethyl-2-oxoquinoline-3-carboxylate
SMILESCOC(=O)c1c(O)c2c(C)c(C)ccc2n(C)c1=O
InChIInChI=1S/C14H15NO4/c1-7-5-6-9-10(8(7)2)12(16)11(14(18)19-4)13(17)15(9)3/h5-6,16H,1-4H3
InChIKeyRNDOWDQJQXQRFR-UHFFFAOYSA-N
XLogP1.65
TPSA68.53 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500261.28
LogP ≤ 51.65
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 4-hydroxy-1,5,6-trimethyl-2-oxoquinoline-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-hydroxy-1,5,6-trimethyl-2-oxoquinoline-3-carboxylate?
The IUPAC name of methyl 4-hydroxy-1,5,6-trimethyl-2-oxoquinoline-3-carboxylate (CID 54737384) is methyl 4-hydroxy-1,5,6-trimethyl-2-oxoquinoline-3-carboxylate.
What is the SMILES notation for methyl 4-hydroxy-1,5,6-trimethyl-2-oxoquinoline-3-carboxylate?
The canonical SMILES for methyl 4-hydroxy-1,5,6-trimethyl-2-oxoquinoline-3-carboxylate is COC(=O)c1c(O)c2c(C)c(C)ccc2n(C)c1=O.
What is the InChIKey of methyl 4-hydroxy-1,5,6-trimethyl-2-oxoquinoline-3-carboxylate?
The InChIKey is RNDOWDQJQXQRFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO4/c1-7-5-6-9-10(8(7)2)12(16)11(14(18)19-4)13(17)15(9)3/h5-6,16H,1-4H3.
What are the key properties of methyl 4-hydroxy-1,5,6-trimethyl-2-oxoquinoline-3-carboxylate?
methyl 4-hydroxy-1,5,6-trimethyl-2-oxoquinoline-3-carboxylate has a molecular weight of 261.28 g/mol, XLogP of 1.65, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-hydroxy-1,5,6-trimethyl-2-oxoquinoline-3-carboxylate is sourced from PubChem (CID 54737384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).