C23H24N2O5 — CID 54706041
N-(6-benzamidohexyl)-4-hydroxy-2-oxochromene-3-carboxamide (PubChem CID 54706041) has the molecular formula C23H24N2O5 and a molecular weight of 408.45 g/mol. Its IUPAC name is N-(6-benzamidohexyl)-4-hydroxy-2-oxochromene-3-carboxamide.
| Compound Name | N-(6-benzamidohexyl)-4-hydroxy-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 54706041 |
| Molecular Formula | C23H24N2O5 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | N-(6-benzamidohexyl)-4-hydroxy-2-oxochromene-3-carboxamide |
| SMILES | O=C(NCCCCCCNC(=O)c1c(O)c2ccccc2oc1=O)c1ccccc1 |
| InChI | InChI=1S/C23H24N2O5/c26-20-17-12-6-7-13-18(17)30-23(29)19(20)22(28)25-15-9-2-1-8-14-24-21(27)16-10-4-3-5-11-16/h3-7,10-13,26H,1-2,8-9,14-15H2,(H,24,27)(H,25,28) |
| InChIKey | OSPDUYRXGXKVEG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|