C13H14N2O6S — CID 54715285
4-hydroxy-N-[2-(methanesulfonamido)ethyl]-2-oxochromene-3-carboxamide (PubChem CID 54715285) has the molecular formula C13H14N2O6S and a molecular weight of 326.33 g/mol. Its IUPAC name is 4-hydroxy-N-[2-(methanesulfonamido)ethyl]-2-oxochromene-3-carboxamide.
| Compound Name | 4-hydroxy-N-[2-(methanesulfonamido)ethyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 54715285 |
| Molecular Formula | C13H14N2O6S |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 4-hydroxy-N-[2-(methanesulfonamido)ethyl]-2-oxochromene-3-carboxamide |
| SMILES | CS(=O)(=O)NCCNC(=O)c1c(O)c2ccccc2oc1=O |
| InChI | InChI=1S/C13H14N2O6S/c1-22(19,20)15-7-6-14-12(17)10-11(16)8-4-2-3-5-9(8)21-13(10)18/h2-5,15-16H,6-7H2,1H3,(H,14,17) |
| InChIKey | HFFKZWXKSIEMPQ-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 125.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|