C15H23F2NO3 — CID 170587481
2,6-difluoro-4-morpholin-4-ylbenzoic acid;ethane (PubChem CID 170587481) has the molecular formula C15H23F2NO3 and a molecular weight of 303.35 g/mol. Its IUPAC name is 2,6-difluoro-4-morpholin-4-ylbenzoic acid;ethane.
| Compound Name | 2,6-difluoro-4-morpholin-4-ylbenzoic acid;ethane |
|---|---|
| PubChem CID | 170587481 |
| Molecular Formula | C15H23F2NO3 |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 2,6-difluoro-4-morpholin-4-ylbenzoic acid;ethane |
| SMILES | CC.CC.O=C(O)c1c(F)cc(N2CCOCC2)cc1F |
| InChI | InChI=1S/C11H11F2NO3.2C2H6/c12-8-5-7(14-1-3-17-4-2-14)6-9(13)10(8)11(15)16;2*1-2/h5-6H,1-4H2,(H,15,16);2*1-2H3 |
| InChIKey | IQEOXYIIUYETRV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |