C10H13NO3 — CID 58923367
5-morpholin-4-ylbenzene-1,3-diol (PubChem CID 58923367) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is 5-morpholin-4-ylbenzene-1,3-diol.
| Compound Name | 5-morpholin-4-ylbenzene-1,3-diol |
|---|---|
| PubChem CID | 58923367 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 5-morpholin-4-ylbenzene-1,3-diol |
| SMILES | Oc1cc(O)cc(N2CCOCC2)c1 |
| InChI | InChI=1S/C10H13NO3/c12-9-5-8(6-10(13)7-9)11-1-3-14-4-2-11/h5-7,12-13H,1-4H2 |
| InChIKey | YFFICENSWTUOCJ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |