C14H12Cl5N3O — CID 159726941
4-(2,6-dichloro-4-pyridinyl)morpholine;2,4,6-trichloropyridine (PubChem CID 159726941) has the molecular formula C14H12Cl5N3O and a molecular weight of 415.54 g/mol. Its IUPAC name is 4-(2,6-dichloro-4-pyridinyl)morpholine;2,4,6-trichloropyridine.
| Compound Name | 4-(2,6-dichloro-4-pyridinyl)morpholine;2,4,6-trichloropyridine |
|---|---|
| PubChem CID | 159726941 |
| Molecular Formula | C14H12Cl5N3O |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 412.94 |
| IUPAC Name | 4-(2,6-dichloro-4-pyridinyl)morpholine;2,4,6-trichloropyridine |
| SMILES | Clc1cc(Cl)nc(Cl)c1.Clc1cc(N2CCOCC2)cc(Cl)n1 |
| InChI | InChI=1S/C9H10Cl2N2O.C5H2Cl3N/c10-8-5-7(6-9(11)12-8)13-1-3-14-4-2-13;6-3-1-4(7)9-5(8)2-3/h5-6H,1-4H2;1-2H |
| InChIKey | NATGWNZJIQQXON-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|