C20H25Cl5N4O2 — CID 162142355
1-(2,6-dichloro-4-pyridinyl)piperidin-4-ol;piperidin-4-ol;2,4,6-trichloropyridine (PubChem CID 162142355) has the molecular formula C20H25Cl5N4O2 and a molecular weight of 530.71 g/mol. Its IUPAC name is 1-(2,6-dichloro-4-pyridinyl)piperidin-4-ol;piperidin-4-ol;2,4,6-trichloropyridine.
| Compound Name | 1-(2,6-dichloro-4-pyridinyl)piperidin-4-ol;piperidin-4-ol;2,4,6-trichloropyridine |
|---|---|
| PubChem CID | 162142355 |
| Molecular Formula | C20H25Cl5N4O2 |
| Molecular Weight | 530.71 g/mol |
| Exact Mass | 528.04 |
| IUPAC Name | 1-(2,6-dichloro-4-pyridinyl)piperidin-4-ol;piperidin-4-ol;2,4,6-trichloropyridine |
| SMILES | Clc1cc(Cl)nc(Cl)c1.OC1CCN(c2cc(Cl)nc(Cl)c2)CC1.OC1CCNCC1 |
| InChI | InChI=1S/C10H12Cl2N2O.C5H2Cl3N.C5H11NO/c11-9-5-7(6-10(12)13-9)14-3-1-8(15)2-4-14;6-3-1-4(7)9-5(8)2-3;7-5-1-3-6-4-2-5/h5-6,8,15H,1-4H2;1-2H;5-7H,1-4H2 |
| InChIKey | ZKCAWZWDKUZPAJ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.71 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|