C18H22N4O3 — CID 58507745
5-(4,6-dimorpholin-4-yl-2-pyridinyl)pyridin-3-ol (PubChem CID 58507745) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is 5-(4,6-dimorpholin-4-yl-2-pyridinyl)pyridin-3-ol.
| Compound Name | 5-(4,6-dimorpholin-4-yl-2-pyridinyl)pyridin-3-ol |
|---|---|
| PubChem CID | 58507745 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 5-(4,6-dimorpholin-4-yl-2-pyridinyl)pyridin-3-ol |
| SMILES | Oc1cncc(-c2cc(N3CCOCC3)cc(N3CCOCC3)n2)c1 |
| InChI | InChI=1S/C18H22N4O3/c23-16-9-14(12-19-13-16)17-10-15(21-1-5-24-6-2-21)11-18(20-17)22-3-7-25-8-4-22/h9-13,23H,1-8H2 |
| InChIKey | ZYHSBIRBQWHMGS-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |