C19H21F3N4O3 — CID 58508094
5-(4,6-dimorpholin-4-yl-2-pyridinyl)-4-(trifluoromethyl)-1H-pyridin-2-one (PubChem CID 58508094) has the molecular formula C19H21F3N4O3 and a molecular weight of 410.40 g/mol. Its IUPAC name is 5-(4,6-dimorpholin-4-yl-2-pyridinyl)-4-(trifluoromethyl)-1H-pyridin-2-one.
| Compound Name | 5-(4,6-dimorpholin-4-yl-2-pyridinyl)-4-(trifluoromethyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 58508094 |
| Molecular Formula | C19H21F3N4O3 |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 5-(4,6-dimorpholin-4-yl-2-pyridinyl)-4-(trifluoromethyl)-1H-pyridin-2-one |
| SMILES | O=c1cc(C(F)(F)F)c(-c2cc(N3CCOCC3)cc(N3CCOCC3)n2)c[nH]1 |
| InChI | InChI=1S/C19H21F3N4O3/c20-19(21,22)15-11-18(27)23-12-14(15)16-9-13(25-1-5-28-6-2-25)10-17(24-16)26-3-7-29-8-4-26/h9-12H,1-8H2,(H,23,27) |
| InChIKey | QPJGICMSDMPZOZ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 70.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |