C8H10ClN3O2 — CID 137130492
2-chloro-4-morpholin-4-yl-1H-pyrimidin-6-one (PubChem CID 137130492) has the molecular formula C8H10ClN3O2 and a molecular weight of 215.64 g/mol. Its IUPAC name is 2-chloro-4-morpholin-4-yl-1H-pyrimidin-6-one.
| Compound Name | 2-chloro-4-morpholin-4-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137130492 |
| Molecular Formula | C8H10ClN3O2 |
| Molecular Weight | 215.64 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | 2-chloro-4-morpholin-4-yl-1H-pyrimidin-6-one |
| SMILES | O=c1cc(N2CCOCC2)nc(Cl)[nH]1 |
| InChI | InChI=1S/C8H10ClN3O2/c9-8-10-6(5-7(13)11-8)12-1-3-14-4-2-12/h5H,1-4H2,(H,10,11,13) |
| InChIKey | MWAYIQCZGKLBMX-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.64 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |