C16H24N2O — CID 16638574
3,5-di(piperidin-1-yl)phenol (PubChem CID 16638574) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is 3,5-di(piperidin-1-yl)phenol.
| Compound Name | 3,5-di(piperidin-1-yl)phenol |
|---|---|
| PubChem CID | 16638574 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 3,5-di(piperidin-1-yl)phenol |
| SMILES | Oc1cc(N2CCCCC2)cc(N2CCCCC2)c1 |
| InChI | InChI=1S/C16H24N2O/c19-16-12-14(17-7-3-1-4-8-17)11-15(13-16)18-9-5-2-6-10-18/h11-13,19H,1-10H2 |
| InChIKey | UAOVWFPXCDXKKW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |