C10H10F3N — CID 67937065
1-(3,4,5-trifluorophenyl)pyrrolidine (PubChem CID 67937065) has the molecular formula C10H10F3N and a molecular weight of 201.19 g/mol. Its IUPAC name is 1-(3,4,5-trifluorophenyl)pyrrolidine.
| Compound Name | 1-(3,4,5-trifluorophenyl)pyrrolidine |
|---|---|
| PubChem CID | 67937065 |
| Molecular Formula | C10H10F3N |
| Molecular Weight | 201.19 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 1-(3,4,5-trifluorophenyl)pyrrolidine |
| SMILES | Fc1cc(N2CCCC2)cc(F)c1F |
| InChI | InChI=1S/C10H10F3N/c11-8-5-7(6-9(12)10(8)13)14-3-1-2-4-14/h5-6H,1-4H2 |
| InChIKey | DWWYMINFUFOHNB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.19 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|