C10H9BrF3N — CID 168512097
1-(6-bromo-2,3,4-trifluorophenyl)pyrrolidine (PubChem CID 168512097) has the molecular formula C10H9BrF3N and a molecular weight of 280.09 g/mol. Its IUPAC name is 1-(6-bromo-2,3,4-trifluorophenyl)pyrrolidine.
| Compound Name | 1-(6-bromo-2,3,4-trifluorophenyl)pyrrolidine |
|---|---|
| PubChem CID | 168512097 |
| Molecular Formula | C10H9BrF3N |
| Molecular Weight | 280.09 g/mol |
| Exact Mass | 278.99 |
| IUPAC Name | 1-(6-bromo-2,3,4-trifluorophenyl)pyrrolidine |
| SMILES | Fc1cc(Br)c(N2CCCC2)c(F)c1F |
| InChI | InChI=1S/C10H9BrF3N/c11-6-5-7(12)8(13)9(14)10(6)15-3-1-2-4-15/h5H,1-4H2 |
| InChIKey | KEUPZEWLXTVXDB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.09 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|