C10H10BrF2NO — CID 84714714
4-(2-bromo-4,6-difluorophenyl)morpholine (PubChem CID 84714714) has the molecular formula C10H10BrF2NO and a molecular weight of 278.10 g/mol. Its IUPAC name is 4-(2-bromo-4,6-difluorophenyl)morpholine.
| Compound Name | 4-(2-bromo-4,6-difluorophenyl)morpholine |
|---|---|
| PubChem CID | 84714714 |
| Molecular Formula | C10H10BrF2NO |
| Molecular Weight | 278.10 g/mol |
| Exact Mass | 276.99 |
| IUPAC Name | 4-(2-bromo-4,6-difluorophenyl)morpholine |
| SMILES | Fc1cc(F)c(N2CCOCC2)c(Br)c1 |
| InChI | InChI=1S/C10H10BrF2NO/c11-8-5-7(12)6-9(13)10(8)14-1-3-15-4-2-14/h5-6H,1-4H2 |
| InChIKey | JAJQUCZWXAVOKF-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.10 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |