C10H12F2N2O — CID 81312473
3,5-difluoro-2-morpholin-4-ylaniline (PubChem CID 81312473) has the molecular formula C10H12F2N2O and a molecular weight of 214.22 g/mol. Its IUPAC name is 3,5-difluoro-2-morpholin-4-ylaniline.
| Compound Name | 3,5-difluoro-2-morpholin-4-ylaniline |
|---|---|
| PubChem CID | 81312473 |
| Molecular Formula | C10H12F2N2O |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 3,5-difluoro-2-morpholin-4-ylaniline |
| SMILES | Nc1cc(F)cc(F)c1N1CCOCC1 |
| InChI | InChI=1S/C10H12F2N2O/c11-7-5-8(12)10(9(13)6-7)14-1-3-15-4-2-14/h5-6H,1-4,13H2 |
| InChIKey | VMRVZWDNYHGWNJ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|