C10H9BrF2N2O2 — CID 168515363
1-(2-bromo-3,4-difluoro-6-nitrophenyl)pyrrolidine (PubChem CID 168515363) has the molecular formula C10H9BrF2N2O2 and a molecular weight of 307.09 g/mol. Its IUPAC name is 1-(2-bromo-3,4-difluoro-6-nitrophenyl)pyrrolidine.
| Compound Name | 1-(2-bromo-3,4-difluoro-6-nitrophenyl)pyrrolidine |
|---|---|
| PubChem CID | 168515363 |
| Molecular Formula | C10H9BrF2N2O2 |
| Molecular Weight | 307.09 g/mol |
| Exact Mass | 305.98 |
| IUPAC Name | 1-(2-bromo-3,4-difluoro-6-nitrophenyl)pyrrolidine |
| SMILES | O=[N+]([O-])c1cc(F)c(F)c(Br)c1N1CCCC1 |
| InChI | InChI=1S/C10H9BrF2N2O2/c11-8-9(13)6(12)5-7(15(16)17)10(8)14-3-1-2-4-14/h5H,1-4H2 |
| InChIKey | QKTRWCHQAISGGZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.09 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|