3,5-dinitro-4-pyrrolidin-1-ylbenzoic acid

C11H11N3O6 — CID 12005642

IUPAC3,5-dinitro-4-pyrrolidin-1-ylbenzoic acid
SMILESO=C(O)c1cc([N+](=O)[O-])c(N2CCCC2)c([N+](=O)[O-])c1
InChIInChI=1S/C11H11N3O6/c15-11(16)7-5-8(13(17)18)10(9(6-7)14(19)20)12-3-1-2-4-12/h5-6H,1-4H2,(H,15,16)
InChIKeyDJLPDYUHXZZEHS-UHFFFAOYSA-N
MW281.22 g/mol
LogP1.80
Rot. Bonds4

About 3,5-dinitro-4-pyrrolidin-1-ylbenzoic acid

3,5-dinitro-4-pyrrolidin-1-ylbenzoic acid (PubChem CID 12005642) has the molecular formula C11H11N3O6 and a molecular weight of 281.22 g/mol. Its IUPAC name is 3,5-dinitro-4-pyrrolidin-1-ylbenzoic acid.

Molecular Properties

Compound Name3,5-dinitro-4-pyrrolidin-1-ylbenzoic acid
PubChem CID12005642
Molecular FormulaC11H11N3O6
Molecular Weight281.22 g/mol
Exact Mass281.06
IUPAC Name3,5-dinitro-4-pyrrolidin-1-ylbenzoic acid
SMILESO=C(O)c1cc([N+](=O)[O-])c(N2CCCC2)c([N+](=O)[O-])c1
InChIInChI=1S/C11H11N3O6/c15-11(16)7-5-8(13(17)18)10(9(6-7)14(19)20)12-3-1-2-4-12/h5-6H,1-4H2,(H,15,16)
InChIKeyDJLPDYUHXZZEHS-UHFFFAOYSA-N
XLogP1.80
TPSA126.82 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500281.22
LogP ≤ 51.80
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 3,5-dinitro-4-pyrrolidin-1-ylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,5-dinitro-4-pyrrolidin-1-ylbenzoic acid?
The IUPAC name of 3,5-dinitro-4-pyrrolidin-1-ylbenzoic acid (CID 12005642) is 3,5-dinitro-4-pyrrolidin-1-ylbenzoic acid.
What is the SMILES notation for 3,5-dinitro-4-pyrrolidin-1-ylbenzoic acid?
The canonical SMILES for 3,5-dinitro-4-pyrrolidin-1-ylbenzoic acid is O=C(O)c1cc([N+](=O)[O-])c(N2CCCC2)c([N+](=O)[O-])c1.
What is the InChIKey of 3,5-dinitro-4-pyrrolidin-1-ylbenzoic acid?
The InChIKey is DJLPDYUHXZZEHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3O6/c15-11(16)7-5-8(13(17)18)10(9(6-7)14(19)20)12-3-1-2-4-12/h5-6H,1-4H2,(H,15,16).
What are the key properties of 3,5-dinitro-4-pyrrolidin-1-ylbenzoic acid?
3,5-dinitro-4-pyrrolidin-1-ylbenzoic acid has a molecular weight of 281.22 g/mol, XLogP of 1.80, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dinitro-4-pyrrolidin-1-ylbenzoic acid is sourced from PubChem (CID 12005642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).