C11H11N3O6 — CID 12005642
3,5-dinitro-4-pyrrolidin-1-ylbenzoic acid (PubChem CID 12005642) has the molecular formula C11H11N3O6 and a molecular weight of 281.22 g/mol. Its IUPAC name is 3,5-dinitro-4-pyrrolidin-1-ylbenzoic acid.
| Compound Name | 3,5-dinitro-4-pyrrolidin-1-ylbenzoic acid |
|---|---|
| PubChem CID | 12005642 |
| Molecular Formula | C11H11N3O6 |
| Molecular Weight | 281.22 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 3,5-dinitro-4-pyrrolidin-1-ylbenzoic acid |
| SMILES | O=C(O)c1cc([N+](=O)[O-])c(N2CCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H11N3O6/c15-11(16)7-5-8(13(17)18)10(9(6-7)14(19)20)12-3-1-2-4-12/h5-6H,1-4H2,(H,15,16) |
| InChIKey | DJLPDYUHXZZEHS-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.22 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|