C26H24N5O5+ — CID 5258759
(2-benzylbenzimidazol-3-ium-1-yl)-(3,5-dinitro-4-piperidin-1-ylphenyl)methanone (PubChem CID 5258759) has the molecular formula C26H24N5O5+ and a molecular weight of 486.51 g/mol. Its IUPAC name is (2-benzylbenzimidazol-3-ium-1-yl)-(3,5-dinitro-4-piperidin-1-ylphenyl)methanone.
| Compound Name | (2-benzylbenzimidazol-3-ium-1-yl)-(3,5-dinitro-4-piperidin-1-ylphenyl)methanone |
|---|---|
| PubChem CID | 5258759 |
| Molecular Formula | C26H24N5O5+ |
| Molecular Weight | 486.51 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | (2-benzylbenzimidazol-3-ium-1-yl)-(3,5-dinitro-4-piperidin-1-ylphenyl)methanone |
| SMILES | O=C(c1cc([N+](=O)[O-])c(N2CCCCC2)c([N+](=O)[O-])c1)n1c(Cc2ccccc2)[nH+]c2ccccc21 |
| InChI | InChI=1S/C26H23N5O5/c32-26(29-21-12-6-5-11-20(21)27-24(29)15-18-9-3-1-4-10-18)19-16-22(30(33)34)25(23(17-19)31(35)36)28-13-7-2-8-14-28/h1,3-6,9-12,16-17H,2,7-8,13-15H2/p+1 |
| InChIKey | IDSZMYSJMUOHJL-UHFFFAOYSA-O |
| XLogP | 4.54 |
| TPSA | 125.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.51 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|