C17H14N6O6 — CID 5259233
benzotriazol-1-yl-(4-morpholin-4-yl-3,5-dinitrophenyl)methanone (PubChem CID 5259233) has the molecular formula C17H14N6O6 and a molecular weight of 398.34 g/mol. Its IUPAC name is benzotriazol-1-yl-(4-morpholin-4-yl-3,5-dinitrophenyl)methanone.
| Compound Name | benzotriazol-1-yl-(4-morpholin-4-yl-3,5-dinitrophenyl)methanone |
|---|---|
| PubChem CID | 5259233 |
| Molecular Formula | C17H14N6O6 |
| Molecular Weight | 398.34 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | benzotriazol-1-yl-(4-morpholin-4-yl-3,5-dinitrophenyl)methanone |
| SMILES | O=C(c1cc([N+](=O)[O-])c(N2CCOCC2)c([N+](=O)[O-])c1)n1nnc2ccccc21 |
| InChI | InChI=1S/C17H14N6O6/c24-17(21-13-4-2-1-3-12(13)18-19-21)11-9-14(22(25)26)16(15(10-11)23(27)28)20-5-7-29-8-6-20/h1-4,9-10H,5-8H2 |
| InChIKey | UOLRNPCDPYHUIG-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 146.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.34 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|