C21H16N6O5 — CID 5209634
benzotriazol-1-yl-[4-(2,4-dimethylanilino)-3,5-dinitrophenyl]methanone (PubChem CID 5209634) has the molecular formula C21H16N6O5 and a molecular weight of 432.40 g/mol. Its IUPAC name is benzotriazol-1-yl-[4-(2,4-dimethylanilino)-3,5-dinitrophenyl]methanone.
| Compound Name | benzotriazol-1-yl-[4-(2,4-dimethylanilino)-3,5-dinitrophenyl]methanone |
|---|---|
| PubChem CID | 5209634 |
| Molecular Formula | C21H16N6O5 |
| Molecular Weight | 432.40 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | benzotriazol-1-yl-[4-(2,4-dimethylanilino)-3,5-dinitrophenyl]methanone |
| SMILES | Cc1ccc(Nc2c([N+](=O)[O-])cc(C(=O)n3nnc4ccccc43)cc2[N+](=O)[O-])c(C)c1 |
| InChI | InChI=1S/C21H16N6O5/c1-12-7-8-15(13(2)9-12)22-20-18(26(29)30)10-14(11-19(20)27(31)32)21(28)25-17-6-4-3-5-16(17)23-24-25/h3-11,22H,1-2H3 |
| InChIKey | HXTORPJNLJOCLO-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 146.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.40 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|