C13H7Cl2N3O — CID 146164024
benzotriazol-1-yl-(3,5-dichlorophenyl)methanone (PubChem CID 146164024) has the molecular formula C13H7Cl2N3O and a molecular weight of 292.13 g/mol. Its IUPAC name is benzotriazol-1-yl-(3,5-dichlorophenyl)methanone.
| Compound Name | benzotriazol-1-yl-(3,5-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 146164024 |
| Molecular Formula | C13H7Cl2N3O |
| Molecular Weight | 292.13 g/mol |
| Exact Mass | 291.00 |
| IUPAC Name | benzotriazol-1-yl-(3,5-dichlorophenyl)methanone |
| SMILES | O=C(c1cc(Cl)cc(Cl)c1)n1nnc2ccccc21 |
| InChI | InChI=1S/C13H7Cl2N3O/c14-9-5-8(6-10(15)7-9)13(19)18-12-4-2-1-3-11(12)16-17-18/h1-7H |
| InChIKey | KWWNFXLEGKVDRJ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.13 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |