C31H51N3O4Si3 — CID 102229671
benzotriazol-1-yl-[3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]phenyl]methanone (PubChem CID 102229671) has the molecular formula C31H51N3O4Si3 and a molecular weight of 614.02 g/mol. Its IUPAC name is benzotriazol-1-yl-[3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]phenyl]methanone.
| Compound Name | benzotriazol-1-yl-[3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]phenyl]methanone |
|---|---|
| PubChem CID | 102229671 |
| Molecular Formula | C31H51N3O4Si3 |
| Molecular Weight | 614.02 g/mol |
| Exact Mass | 613.32 |
| IUPAC Name | benzotriazol-1-yl-[3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]phenyl]methanone |
| SMILES | CC(C)(C)[Si](C)(C)Oc1cc(C(=O)n2nnc3ccccc32)cc(O[Si](C)(C)C(C)(C)C)c1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H51N3O4Si3/c1-29(2,3)39(10,11)36-25-20-22(28(35)34-24-19-17-16-18-23(24)32-33-34)21-26(37-40(12,13)30(4,5)6)27(25)38-41(14,15)31(7,8)9/h16-21H,1-15H3 |
| InChIKey | CNOIXAIQRZMUHA-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.02 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|