C23H20N4O3 — CID 156773387
(E)-3-amino-2-(benzotriazol-1-yl)-1-(3,4-dimethoxyphenyl)-3-phenylprop-2-en-1-one (PubChem CID 156773387) has the molecular formula C23H20N4O3 and a molecular weight of 400.44 g/mol. Its IUPAC name is (E)-3-amino-2-(benzotriazol-1-yl)-1-(3,4-dimethoxyphenyl)-3-phenylprop-2-en-1-one.
| Compound Name | (E)-3-amino-2-(benzotriazol-1-yl)-1-(3,4-dimethoxyphenyl)-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 156773387 |
| Molecular Formula | C23H20N4O3 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | (E)-3-amino-2-(benzotriazol-1-yl)-1-(3,4-dimethoxyphenyl)-3-phenylprop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C(=C(\N)c2ccccc2)n2nnc3ccccc32)cc1OC |
| InChI | InChI=1S/C23H20N4O3/c1-29-19-13-12-16(14-20(19)30-2)23(28)22(21(24)15-8-4-3-5-9-15)27-18-11-7-6-10-17(18)25-26-27/h3-14H,24H2,1-2H3/b22-21+ |
| InChIKey | GXRSBBKMSHWJJO-QURGRASLSA-N |
| XLogP | 3.62 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|