C22H14N4O7 — CID 5209378
1-(4-anilino-3,5-dinitrobenzoyl)-5-methylindole-2,3-dione (PubChem CID 5209378) has the molecular formula C22H14N4O7 and a molecular weight of 446.38 g/mol. Its IUPAC name is 1-(4-anilino-3,5-dinitrobenzoyl)-5-methylindole-2,3-dione.
| Compound Name | 1-(4-anilino-3,5-dinitrobenzoyl)-5-methylindole-2,3-dione |
|---|---|
| PubChem CID | 5209378 |
| Molecular Formula | C22H14N4O7 |
| Molecular Weight | 446.38 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | 1-(4-anilino-3,5-dinitrobenzoyl)-5-methylindole-2,3-dione |
| SMILES | Cc1ccc2c(c1)C(=O)C(=O)N2C(=O)c1cc([N+](=O)[O-])c(Nc2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H14N4O7/c1-12-7-8-16-15(9-12)20(27)22(29)24(16)21(28)13-10-17(25(30)31)19(18(11-13)26(32)33)23-14-5-3-2-4-6-14/h2-11,23H,1H3 |
| InChIKey | WROBUNNJDZHRPD-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 152.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|