C29H21N5O6 — CID 5241316
(4,5-diphenylimidazol-1-yl)-[4-(4-methoxyanilino)-3,5-dinitrophenyl]methanone (PubChem CID 5241316) has the molecular formula C29H21N5O6 and a molecular weight of 535.52 g/mol. Its IUPAC name is (4,5-diphenylimidazol-1-yl)-[4-(4-methoxyanilino)-3,5-dinitrophenyl]methanone.
| Compound Name | (4,5-diphenylimidazol-1-yl)-[4-(4-methoxyanilino)-3,5-dinitrophenyl]methanone |
|---|---|
| PubChem CID | 5241316 |
| Molecular Formula | C29H21N5O6 |
| Molecular Weight | 535.52 g/mol |
| Exact Mass | 535.15 |
| IUPAC Name | (4,5-diphenylimidazol-1-yl)-[4-(4-methoxyanilino)-3,5-dinitrophenyl]methanone |
| SMILES | COc1ccc(Nc2c([N+](=O)[O-])cc(C(=O)n3cnc(-c4ccccc4)c3-c3ccccc3)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C29H21N5O6/c1-40-23-14-12-22(13-15-23)31-27-24(33(36)37)16-21(17-25(27)34(38)39)29(35)32-18-30-26(19-8-4-2-5-9-19)28(32)20-10-6-3-7-11-20/h2-18,31H,1H3 |
| InChIKey | IAEDXQKUXPSRMU-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 142.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.52 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|